C15H22O — CID 11172007
(2R,3S)-3-methyl-2-(2,4,6-trimethylphenyl)pent-4-en-2-ol (PubChem CID 11172007) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-(2,4,6-trimethylphenyl)pent-4-en-2-ol.
| Compound Name | (2R,3S)-3-methyl-2-(2,4,6-trimethylphenyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 11172007 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2R,3S)-3-methyl-2-(2,4,6-trimethylphenyl)pent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@@](C)(O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H22O/c1-7-13(5)15(6,16)14-11(3)8-10(2)9-12(14)4/h7-9,13,16H,1H2,2-6H3/t13-,15+/m0/s1 |
| InChIKey | YFXUBNSDSRQTJI-DZGCQCFKSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|