C18H19NO2 — CID 146162226
(2S,3S)-3-(6-methoxy-3-pyridinyl)-2-methyl-2-phenylpent-4-enal (PubChem CID 146162226) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S,3S)-3-(6-methoxy-3-pyridinyl)-2-methyl-2-phenylpent-4-enal.
| Compound Name | (2S,3S)-3-(6-methoxy-3-pyridinyl)-2-methyl-2-phenylpent-4-enal |
|---|---|
| PubChem CID | 146162226 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S,3S)-3-(6-methoxy-3-pyridinyl)-2-methyl-2-phenylpent-4-enal |
| SMILES | C=C[C@@H](c1ccc(OC)nc1)[C@](C)(C=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-4-16(14-10-11-17(21-3)19-12-14)18(2,13-20)15-8-6-5-7-9-15/h4-13,16H,1H2,2-3H3/t16-,18+/m0/s1 |
| InChIKey | LXLVARVYYSZDFM-FUHWJXTLSA-N |
| XLogP | 3.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|