C12H17NO2 — CID 166443721
(2R,3S)-2-(6-methoxy-3-pyridinyl)-3-methylpent-4-en-2-ol (PubChem CID 166443721) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2R,3S)-2-(6-methoxy-3-pyridinyl)-3-methylpent-4-en-2-ol.
| Compound Name | (2R,3S)-2-(6-methoxy-3-pyridinyl)-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 166443721 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2R,3S)-2-(6-methoxy-3-pyridinyl)-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@@](C)(O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C12H17NO2/c1-5-9(2)12(3,14)10-6-7-11(15-4)13-8-10/h5-9,14H,1H2,2-4H3/t9-,12+/m0/s1 |
| InChIKey | QRPZCYIRPRROTP-JOYOIKCWSA-N |
| XLogP | 2.12 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|