C25H31NO6S — CID 72508561
1-[2-(but-3-en-2-yloxymethylidene)hexylsulfonyl]-2-[(4-methoxyphenyl)methyl]-4-nitrobenzene (PubChem CID 72508561) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[2-(but-3-en-2-yloxymethylidene)hexylsulfonyl]-2-[(4-methoxyphenyl)methyl]-4-nitrobenzene.
| Compound Name | 1-[2-(but-3-en-2-yloxymethylidene)hexylsulfonyl]-2-[(4-methoxyphenyl)methyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 72508561 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[2-(but-3-en-2-yloxymethylidene)hexylsulfonyl]-2-[(4-methoxyphenyl)methyl]-4-nitrobenzene |
| SMILES | C=CC(C)OC=C(CCCC)CS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H31NO6S/c1-5-7-8-21(17-32-19(3)6-2)18-33(29,30)25-14-11-23(26(27)28)16-22(25)15-20-9-12-24(31-4)13-10-20/h6,9-14,16-17,19H,2,5,7-8,15,18H2,1,3-4H3 |
| InChIKey | KIWGVVVFVDITBP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|