C27H37NO3S — CID 142241568
2-butyl-2-[[dimethylidene-[4-methyl-2-[(3-nitrophenyl)methyl]phenyl]-λ6-sulfanyl]methyl]hexanal (PubChem CID 142241568) has the molecular formula C27H37NO3S and a molecular weight of 455.66 g/mol. Its IUPAC name is 2-butyl-2-[[dimethylidene-[4-methyl-2-[(3-nitrophenyl)methyl]phenyl]-λ6-sulfanyl]methyl]hexanal.
| Compound Name | 2-butyl-2-[[dimethylidene-[4-methyl-2-[(3-nitrophenyl)methyl]phenyl]-λ6-sulfanyl]methyl]hexanal |
|---|---|
| PubChem CID | 142241568 |
| Molecular Formula | C27H37NO3S |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-butyl-2-[[dimethylidene-[4-methyl-2-[(3-nitrophenyl)methyl]phenyl]-λ6-sulfanyl]methyl]hexanal |
| SMILES | C=S(=C)(CC(C=O)(CCCC)CCCC)c1ccc(C)cc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H37NO3S/c1-6-8-15-27(20-29,16-9-7-2)21-32(4,5)26-14-13-22(3)17-24(26)18-23-11-10-12-25(19-23)28(30)31/h10-14,17,19-20H,4-9,15-16,18,21H2,1-3H3 |
| InChIKey | WQXNTJOJNHNMKG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|