C21H25FN2O5S — CID 134186984
4-fluoro-1-[(2S)-2-methyl-2-(nitrosomethyl)hexyl]sulfonyl-2-[(3-nitrophenyl)methyl]benzene (PubChem CID 134186984) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-fluoro-1-[(2S)-2-methyl-2-(nitrosomethyl)hexyl]sulfonyl-2-[(3-nitrophenyl)methyl]benzene.
| Compound Name | 4-fluoro-1-[(2S)-2-methyl-2-(nitrosomethyl)hexyl]sulfonyl-2-[(3-nitrophenyl)methyl]benzene |
|---|---|
| PubChem CID | 134186984 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-fluoro-1-[(2S)-2-methyl-2-(nitrosomethyl)hexyl]sulfonyl-2-[(3-nitrophenyl)methyl]benzene |
| SMILES | CCCC[C@@](C)(CN=O)CS(=O)(=O)c1ccc(F)cc1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-3-4-10-21(2,14-23-25)15-30(28,29)20-9-8-18(22)13-17(20)11-16-6-5-7-19(12-16)24(26)27/h5-9,12-13H,3-4,10-11,14-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | YYBYEGNYDUSZIN-NRFANRHFSA-N |
| XLogP | 5.06 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|