C18H21FN4O2S — CID 111311266
1-[3-(4-fluorophenyl)sulfanylpropyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine (PubChem CID 111311266) has the molecular formula C18H21FN4O2S and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfanylpropyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine.
| Compound Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111311266 |
| Molecular Formula | C18H21FN4O2S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21FN4O2S/c1-20-18(22-13-14-4-2-5-16(12-14)23(24)25)21-10-3-11-26-17-8-6-15(19)7-9-17/h2,4-9,12H,3,10-11,13H2,1H3,(H2,20,21,22) |
| InChIKey | GNKSPIUEMAONLF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|