C20H27FN4O2S2 — CID 111311150
1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine (PubChem CID 111311150) has the molecular formula C20H27FN4O2S2 and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine.
| Compound Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111311150 |
| Molecular Formula | C20H27FN4O2S2 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H27FN4O2S2/c1-22-20(23-13-4-14-28-18-9-7-17(21)8-10-18)24-15-16-5-11-19(12-6-16)29(26,27)25(2)3/h5-12H,4,13-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | GEBOHMTVOIHSRX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|