C21H29FIN3O2S2 — CID 111311375
1-(3-benzylsulfonylpropyl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111311375) has the molecular formula C21H29FIN3O2S2 and a molecular weight of 565.52 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111311375 |
| Molecular Formula | C21H29FIN3O2S2 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCSc1ccc(F)cc1)NCCCS(=O)(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C21H28FN3O2S2.HI/c1-23-21(24-13-5-15-28-20-11-9-19(22)10-12-20)25-14-6-16-29(26,27)17-18-7-3-2-4-8-18;/h2-4,7-12H,5-6,13-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | YFKZYNWLFWICFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|