C19H24FN3O2S2 — CID 111310808
1-[2-(benzenesulfonyl)ethyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine (PubChem CID 111310808) has the molecular formula C19H24FN3O2S2 and a molecular weight of 409.55 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111310808 |
| Molecular Formula | C19H24FN3O2S2 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24FN3O2S2/c1-21-19(22-12-5-14-26-17-10-8-16(20)9-11-17)23-13-15-27(24,25)18-6-3-2-4-7-18/h2-4,6-11H,5,12-15H2,1H3,(H2,21,22,23) |
| InChIKey | VGHZSPZDLOOPPM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|