C18H21F2N3OS — CID 111795485
1-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine (PubChem CID 111795485) has the molecular formula C18H21F2N3OS and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine.
| Compound Name | 1-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111795485 |
| Molecular Formula | C18H21F2N3OS |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C18H21F2N3OS/c1-21-18(23-12-13-3-8-17(24)16(20)11-13)22-9-2-10-25-15-6-4-14(19)5-7-15/h3-8,11,24H,2,9-10,12H2,1H3,(H2,21,22,23) |
| InChIKey | YOVPNUFBHRMWJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|