C23H31FIN5OS — CID 111311135
N-[3-[[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111311135) has the molecular formula C23H31FIN5OS and a molecular weight of 571.50 g/mol. Its IUPAC name is N-[3-[[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111311135 |
| Molecular Formula | C23H31FIN5OS |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | N-[3-[[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCc1cccc(NC(=O)N2CCCC2)c1.I |
| InChI | InChI=1S/C23H30FN5OS.HI/c1-25-22(26-12-5-15-31-21-10-8-19(24)9-11-21)27-17-18-6-4-7-20(16-18)28-23(30)29-13-2-3-14-29;/h4,6-11,16H,2-3,5,12-15,17H2,1H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | UBKYMLPDHRMKAG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|