C25H36N6O — CID 111330678
N-[3-[[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111330678) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[3-[[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111330678 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | N-[3-[[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN(CCN/C(=N\C)NCc1cccc(NC(=O)N2CCCC2)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C25H36N6O/c1-4-30(23-12-7-9-20(2)17-23)16-13-27-24(26-3)28-19-21-10-8-11-22(18-21)29-25(32)31-14-5-6-15-31/h7-12,17-18H,4-6,13-16,19H2,1-3H3,(H,29,32)(H2,26,27,28) |
| InChIKey | ZJPGERDMIUPLPI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|