C26H40IN5O — CID 111765994
1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111765994) has the molecular formula C26H40IN5O and a molecular weight of 565.54 g/mol. Its IUPAC name is 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111765994 |
| Molecular Formula | C26H40IN5O |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N\C)NCc1ccc(CN2CCC(O)CC2)cc1)c1cccc(C)c1.I |
| InChI | InChI=1S/C26H39N5O.HI/c1-4-31(24-7-5-6-21(2)18-24)17-14-28-26(27-3)29-19-22-8-10-23(11-9-22)20-30-15-12-25(32)13-16-30;/h5-11,18,25,32H,4,12-17,19-20H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | OEBCEWHKDBWKCZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|