C25H37IN6O — CID 111390070
N-[3-[[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111390070) has the molecular formula C25H37IN6O and a molecular weight of 564.52 g/mol. Its IUPAC name is N-[3-[[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111390070 |
| Molecular Formula | C25H37IN6O |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | N-[3-[[[N-[3-(N-ethylanilino)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | CCN(CCCN/C(=N\C)NCc1cccc(NC(=O)N2CCCC2)c1)c1ccccc1.I |
| InChI | InChI=1S/C25H36N6O.HI/c1-3-30(23-13-5-4-6-14-23)18-10-15-27-24(26-2)28-20-21-11-9-12-22(19-21)29-25(32)31-16-7-8-17-31;/h4-6,9,11-14,19H,3,7-8,10,15-18,20H2,1-2H3,(H,29,32)(H2,26,27,28);1H |
| InChIKey | GSTOHWYLCPNSHU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|