C40H58IN3O4S — CID 143672432
2-butyl-2-[[4-(dimethylamino)-2-[[4-[[4-[[4-(2-iodoethyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]methyl]phenyl]sulfonylmethyl]hexan-1-ol (PubChem CID 143672432) has the molecular formula C40H58IN3O4S and a molecular weight of 803.89 g/mol. Its IUPAC name is 2-butyl-2-[[4-(dimethylamino)-2-[[4-[[4-[[4-(2-iodoethyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]methyl]phenyl]sulfonylmethyl]hexan-1-ol.
| Compound Name | 2-butyl-2-[[4-(dimethylamino)-2-[[4-[[4-[[4-(2-iodoethyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]methyl]phenyl]sulfonylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 143672432 |
| Molecular Formula | C40H58IN3O4S |
| Molecular Weight | 803.89 g/mol |
| Exact Mass | 803.32 |
| IUPAC Name | 2-butyl-2-[[4-(dimethylamino)-2-[[4-[[4-[[4-(2-iodoethyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]methyl]phenyl]sulfonylmethyl]hexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)CS(=O)(=O)c1ccc(N(C)C)cc1Cc1ccc(OCc2ccc(CN3CCN(CCI)CC3)cc2)cc1 |
| InChI | InChI=1S/C40H58IN3O4S/c1-5-7-19-40(31-45,20-8-6-2)32-49(46,47)39-18-15-37(42(3)4)28-36(39)27-33-13-16-38(17-14-33)48-30-35-11-9-34(10-12-35)29-44-25-23-43(22-21-41)24-26-44/h9-18,28,45H,5-8,19-27,29-32H2,1-4H3 |
| InChIKey | VLNLIMQUHWJCQA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|