C16H18ClNO2S — CID 102670575
[3-chloro-4-[(2,5-dimethylphenyl)sulfonylmethyl]phenyl]methanamine (PubChem CID 102670575) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is [3-chloro-4-[(2,5-dimethylphenyl)sulfonylmethyl]phenyl]methanamine.
| Compound Name | [3-chloro-4-[(2,5-dimethylphenyl)sulfonylmethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 102670575 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [3-chloro-4-[(2,5-dimethylphenyl)sulfonylmethyl]phenyl]methanamine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Cc2ccc(CN)cc2Cl)c1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-11-3-4-12(2)16(7-11)21(19,20)10-14-6-5-13(9-18)8-15(14)17/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | DEPUZYBKQIVRPN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |