C14H13Cl2NO2S — CID 81190195
3-[(2,4-dichlorophenyl)methylsulfonyl]-4-methylaniline (PubChem CID 81190195) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylsulfonyl]-4-methylaniline.
| Compound Name | 3-[(2,4-dichlorophenyl)methylsulfonyl]-4-methylaniline |
|---|---|
| PubChem CID | 81190195 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylsulfonyl]-4-methylaniline |
| SMILES | Cc1ccc(N)cc1S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-9-2-5-12(17)7-14(9)20(18,19)8-10-3-4-11(15)6-13(10)16/h2-7H,8,17H2,1H3 |
| InChIKey | SARSVXISANYNNL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|