C14H20ClNO4S — CID 102670663
tert-butyl 2-[[4-(aminomethyl)-2-chlorophenyl]methylsulfonyl]acetate (PubChem CID 102670663) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is tert-butyl 2-[[4-(aminomethyl)-2-chlorophenyl]methylsulfonyl]acetate.
| Compound Name | tert-butyl 2-[[4-(aminomethyl)-2-chlorophenyl]methylsulfonyl]acetate |
|---|---|
| PubChem CID | 102670663 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | tert-butyl 2-[[4-(aminomethyl)-2-chlorophenyl]methylsulfonyl]acetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)Cc1ccc(CN)cc1Cl |
| InChI | InChI=1S/C14H20ClNO4S/c1-14(2,3)20-13(17)9-21(18,19)8-11-5-4-10(7-16)6-12(11)15/h4-6H,7-9,16H2,1-3H3 |
| InChIKey | KGGKXMWORGTHOM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |