C12H16O7S — CID 116686614
3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylmethyl]furan-2-carboxylic acid (PubChem CID 116686614) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylmethyl]furan-2-carboxylic acid.
| Compound Name | 3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 116686614 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylmethyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)Cc1ccoc1C(=O)O |
| InChI | InChI=1S/C12H16O7S/c1-12(2,3)19-9(13)7-20(16,17)6-8-4-5-18-10(8)11(14)15/h4-5H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | YDRVFBHFPDZXGV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |