C13H16N2O4S — CID 116688148
tert-butyl 2-[(2-cyano-4-pyridinyl)methylsulfonyl]acetate (PubChem CID 116688148) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is tert-butyl 2-[(2-cyano-4-pyridinyl)methylsulfonyl]acetate.
| Compound Name | tert-butyl 2-[(2-cyano-4-pyridinyl)methylsulfonyl]acetate |
|---|---|
| PubChem CID | 116688148 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | tert-butyl 2-[(2-cyano-4-pyridinyl)methylsulfonyl]acetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)Cc1ccnc(C#N)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-13(2,3)19-12(16)9-20(17,18)8-10-4-5-15-11(6-10)7-14/h4-6H,8-9H2,1-3H3 |
| InChIKey | YWWFYDMSJVGSEY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |