C13H18FNO4S — CID 116687271
tert-butyl 2-[(2-amino-4-fluorophenyl)methylsulfonyl]acetate (PubChem CID 116687271) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is tert-butyl 2-[(2-amino-4-fluorophenyl)methylsulfonyl]acetate.
| Compound Name | tert-butyl 2-[(2-amino-4-fluorophenyl)methylsulfonyl]acetate |
|---|---|
| PubChem CID | 116687271 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | tert-butyl 2-[(2-amino-4-fluorophenyl)methylsulfonyl]acetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)Cc1ccc(F)cc1N |
| InChI | InChI=1S/C13H18FNO4S/c1-13(2,3)19-12(16)8-20(17,18)7-9-4-5-10(14)6-11(9)15/h4-6H,7-8,15H2,1-3H3 |
| InChIKey | VFRQIFHKJOJZLJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|