C13H16FNO4 — CID 35714241
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 35714241) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 35714241 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)COC(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C13H16FNO4/c1-13(2,3)19-11(16)7-18-12(17)9-5-4-8(14)6-10(9)15/h4-6H,7,15H2,1-3H3 |
| InChIKey | AUUOKXOEPGAYML-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|