C10H9F4NO3 — CID 106705802
2,2,2-trifluoroethoxymethyl 2-amino-4-fluorobenzoate (PubChem CID 106705802) has the molecular formula C10H9F4NO3 and a molecular weight of 267.18 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxymethyl 2-amino-4-fluorobenzoate.
| Compound Name | 2,2,2-trifluoroethoxymethyl 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 106705802 |
| Molecular Formula | C10H9F4NO3 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2,2,2-trifluoroethoxymethyl 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCOCC(F)(F)F |
| InChI | InChI=1S/C10H9F4NO3/c11-6-1-2-7(8(15)3-6)9(16)18-5-17-4-10(12,13)14/h1-3H,4-5,15H2 |
| InChIKey | XNDNFFDMWMFNCG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|