C10H8Cl2F3NO3 — CID 107199137
2,2,2-trifluoroethoxymethyl 5-amino-2,3-dichlorobenzoate (PubChem CID 107199137) has the molecular formula C10H8Cl2F3NO3 and a molecular weight of 318.08 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxymethyl 5-amino-2,3-dichlorobenzoate.
| Compound Name | 2,2,2-trifluoroethoxymethyl 5-amino-2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 107199137 |
| Molecular Formula | C10H8Cl2F3NO3 |
| Molecular Weight | 318.08 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2,2,2-trifluoroethoxymethyl 5-amino-2,3-dichlorobenzoate |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)OCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H8Cl2F3NO3/c11-7-2-5(16)1-6(8(7)12)9(17)19-4-18-3-10(13,14)15/h1-2H,3-4,16H2 |
| InChIKey | DBHAVEUKFJUJNW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.08 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|