C14H9Cl3FNO2 — CID 107199283
(3-chloro-2-fluorophenyl)methyl 5-amino-2,3-dichlorobenzoate (PubChem CID 107199283) has the molecular formula C14H9Cl3FNO2 and a molecular weight of 348.59 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)methyl 5-amino-2,3-dichlorobenzoate.
| Compound Name | (3-chloro-2-fluorophenyl)methyl 5-amino-2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 107199283 |
| Molecular Formula | C14H9Cl3FNO2 |
| Molecular Weight | 348.59 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | (3-chloro-2-fluorophenyl)methyl 5-amino-2,3-dichlorobenzoate |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)OCc2cccc(Cl)c2F)c1 |
| InChI | InChI=1S/C14H9Cl3FNO2/c15-10-3-1-2-7(13(10)18)6-21-14(20)9-4-8(19)5-11(16)12(9)17/h1-5H,6,19H2 |
| InChIKey | AWQGFLKONYUPOO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|