C14H10ClF2NO2 — CID 61238817
(2,3-difluorophenyl)methyl 4-amino-2-chlorobenzoate (PubChem CID 61238817) has the molecular formula C14H10ClF2NO2 and a molecular weight of 297.69 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl 4-amino-2-chlorobenzoate.
| Compound Name | (2,3-difluorophenyl)methyl 4-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 61238817 |
| Molecular Formula | C14H10ClF2NO2 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (2,3-difluorophenyl)methyl 4-amino-2-chlorobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2cccc(F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2NO2/c15-11-6-9(18)4-5-10(11)14(19)20-7-8-2-1-3-12(16)13(8)17/h1-6H,7,18H2 |
| InChIKey | UWOCBMPDDUQDHY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|