C14H9F4NO2 — CID 61315619
(2,3-difluorophenyl)methyl 5-amino-2,4-difluorobenzoate (PubChem CID 61315619) has the molecular formula C14H9F4NO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl 5-amino-2,4-difluorobenzoate.
| Compound Name | (2,3-difluorophenyl)methyl 5-amino-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 61315619 |
| Molecular Formula | C14H9F4NO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2,3-difluorophenyl)methyl 5-amino-2,4-difluorobenzoate |
| SMILES | Nc1cc(C(=O)OCc2cccc(F)c2F)c(F)cc1F |
| InChI | InChI=1S/C14H9F4NO2/c15-9-3-1-2-7(13(9)18)6-21-14(20)8-4-12(19)11(17)5-10(8)16/h1-5H,6,19H2 |
| InChIKey | ZMXCTNYLGBDIOC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|