C14H12F2N2O3 — CID 63984933
(6-methoxy-2-pyridinyl)methyl 5-amino-2,4-difluorobenzoate (PubChem CID 63984933) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is (6-methoxy-2-pyridinyl)methyl 5-amino-2,4-difluorobenzoate.
| Compound Name | (6-methoxy-2-pyridinyl)methyl 5-amino-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 63984933 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (6-methoxy-2-pyridinyl)methyl 5-amino-2,4-difluorobenzoate |
| SMILES | COc1cccc(COC(=O)c2cc(N)c(F)cc2F)n1 |
| InChI | InChI=1S/C14H12F2N2O3/c1-20-13-4-2-3-8(18-13)7-21-14(19)9-5-12(17)11(16)6-10(9)15/h2-6H,7,17H2,1H3 |
| InChIKey | NNJLHZQNGQIJFA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|