About (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate
(2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate (PubChem CID 102669571) has the molecular formula C15H10Cl2N2O2
and a molecular weight of 321.16 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate.
Molecular Properties
| Compound Name | (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate |
| PubChem CID | 102669571 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccc(N)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-13-5-9(7-18)1-2-10(13)8-21-15(20)12-4-3-11(19)6-14(12)17/h1-6H,8,19H2 |
| InChIKey | KGRUMRAXHQRYNC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate?
The IUPAC name of (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate (CID 102669571) is (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate.
What is the SMILES notation for (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate?
The canonical SMILES for (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate is N#Cc1ccc(COC(=O)c2ccc(N)cc2Cl)c(Cl)c1.
What is the InChIKey of (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate?
The InChIKey is KGRUMRAXHQRYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O2/c16-13-5-9(7-18)1-2-10(13)8-21-15(20)12-4-3-11(19)6-14(12)17/h1-6H,8,19H2.
What are the key properties of (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate?
(2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate has a molecular weight of 321.16 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-cyanophenyl)methyl 4-amino-2-chlorobenzoate is sourced from PubChem (CID 102669571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).