About 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate
2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate (PubChem CID 30764854) has the molecular formula C15H13F2NO3
and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate |
| PubChem CID | 30764854 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F2NO3/c16-10-1-4-12(5-2-10)20-7-8-21-15(19)13-6-3-11(17)9-14(13)18/h1-6,9H,7-8,18H2 |
| InChIKey | HKBWRGXQEYJBRU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate?
The IUPAC name of 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate (CID 30764854) is 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate.
What is the SMILES notation for 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate?
The canonical SMILES for 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate is Nc1cc(F)ccc1C(=O)OCCOc1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate?
The InChIKey is HKBWRGXQEYJBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO3/c16-10-1-4-12(5-2-10)20-7-8-21-15(19)13-6-3-11(17)9-14(13)18/h1-6,9H,7-8,18H2.
What are the key properties of 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate?
2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate has a molecular weight of 293.27 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenoxy)ethyl 2-amino-4-fluorobenzoate is sourced from PubChem (CID 30764854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).