C18H18FN3O4 — CID 9477531
[2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 9477531) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 9477531 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(F)cc2N)cc1C |
| InChI | InChI=1S/C18H18FN3O4/c1-10-3-5-13(7-11(10)2)21-18(25)22-16(23)9-26-17(24)14-6-4-12(19)8-15(14)20/h3-8H,9,20H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | CBDYKSWXAWYMPM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|