C20H22FN3O4 — CID 27998134
[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 2-amino-4-fluorobenzoate (PubChem CID 27998134) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27998134 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl] 2-amino-4-fluorobenzoate |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)COC(=O)c2ccc(F)cc2N)c(C)c1 |
| InChI | InChI=1S/C20H22FN3O4/c1-11-6-12(2)19(13(3)7-11)24-17(25)9-23-18(26)10-28-20(27)15-5-4-14(21)8-16(15)22/h4-8H,9-10,22H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | JCMCSSXLIFOHKS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|