C20H20F3N3O4 — CID 30829410
[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-amino-4-(trifluoromethyl)benzoate (PubChem CID 30829410) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-amino-4-(trifluoromethyl)benzoate.
| Compound Name | [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-amino-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 30829410 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-amino-4-(trifluoromethyl)benzoate |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)COC(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C20H20F3N3O4/c1-11-4-3-5-12(2)18(11)26-16(27)9-25-17(28)10-30-19(29)14-7-6-13(8-15(14)24)20(21,22)23/h3-8H,9-10,24H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | VSHXQRJWGVVTHK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|