C20H22ClN3O4 — CID 8511402
[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8511402) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8511402 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)NCC(=O)Nc2c(C)cccc2C)c(Cl)n1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-11-6-5-7-12(2)18(11)24-15(25)9-22-16(26)10-28-20(27)17-13(3)8-14(4)23-19(17)21/h5-8H,9-10H2,1-4H3,(H,22,26)(H,24,25) |
| InChIKey | GLELSKVFRVGCRC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|