C18H17Cl3N2O3 — CID 8510859
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8510859) has the molecular formula C18H17Cl3N2O3 and a molecular weight of 415.70 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8510859 |
| Molecular Formula | C18H17Cl3N2O3 |
| Molecular Weight | 415.70 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)NCCc2ccc(Cl)cc2Cl)c(Cl)n1 |
| InChI | InChI=1S/C18H17Cl3N2O3/c1-10-7-11(2)23-17(21)16(10)18(25)26-9-15(24)22-6-5-12-3-4-13(19)8-14(12)20/h3-4,7-8H,5-6,9H2,1-2H3,(H,22,24) |
| InChIKey | SVFIBIDGFLWKEM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|