C19H18F3N3O4 — CID 166228493
[2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-amino-2-(trifluoromethyl)benzoate (PubChem CID 166228493) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-amino-2-(trifluoromethyl)benzoate.
| Compound Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-amino-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 166228493 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-[(3,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-amino-2-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(N)cc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C19H18F3N3O4/c1-10-3-5-13(7-11(10)2)24-18(28)25-16(26)9-29-17(27)14-6-4-12(23)8-15(14)19(20,21)22/h3-8H,9,23H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | WJRZVIGKIPVYAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|