C12H11F3N2O4 — CID 2503502
[2-(methylcarbamoylamino)-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 2503502) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2503502 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O4/c1-16-11(20)17-9(18)6-21-10(19)7-4-2-3-5-8(7)12(13,14)15/h2-5H,6H2,1H3,(H2,16,17,18,20) |
| InChIKey | OUNUWKNGRNMLOZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |