C20H20F3NO5 — CID 9009426
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 9009426) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 9009426 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO5/c1-2-27-14-7-9-15(10-8-14)28-12-11-24-18(25)13-29-19(26)16-5-3-4-6-17(16)20(21,22)23/h3-10H,2,11-13H2,1H3,(H,24,25) |
| InChIKey | NTHFDACOBMGZAW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|