C18H17FN2O5 — CID 27998090
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 27998090) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27998090 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCC(=O)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H17FN2O5/c19-11-2-4-13(14(20)8-11)18(23)26-10-17(22)21-12-3-5-15-16(9-12)25-7-1-6-24-15/h2-5,8-9H,1,6-7,10,20H2,(H,21,22) |
| InChIKey | BFJYPRLACREJJH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|