About [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine
[3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine (PubChem CID 102670576) has the molecular formula C16H18ClNO2S
and a molecular weight of 323.85 g/mol. Its IUPAC name is [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine |
| PubChem CID | 102670576 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccc(CN)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-11-3-6-16(12(2)7-11)21(19,20)10-14-5-4-13(9-18)8-15(14)17/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | YOOIDAYZGRFOKF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine?
The IUPAC name of [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine (CID 102670576) is [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine.
What is the SMILES notation for [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine?
The canonical SMILES for [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine is Cc1ccc(S(=O)(=O)Cc2ccc(CN)cc2Cl)c(C)c1.
What is the InChIKey of [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine?
The InChIKey is YOOIDAYZGRFOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO2S/c1-11-3-6-16(12(2)7-11)21(19,20)10-14-5-4-13(9-18)8-15(14)17/h3-8H,9-10,18H2,1-2H3.
What are the key properties of [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine?
[3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine has a molecular weight of 323.85 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4-[(2,4-dimethylphenyl)sulfonylmethyl]phenyl]methanamine is sourced from PubChem (CID 102670576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).