C12H13NO2S — CID 22200809
1-(2,5-dimethylphenyl)sulfonylpyrrole (PubChem CID 22200809) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonylpyrrole.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 22200809 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonylpyrrole |
| SMILES | Cc1ccc(C)c(S(=O)(=O)n2cccc2)c1 |
| InChI | InChI=1S/C12H13NO2S/c1-10-5-6-11(2)12(9-10)16(14,15)13-7-3-4-8-13/h3-9H,1-2H3 |
| InChIKey | DUMYOSSRPSEZCN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |