C12H7ClNa2O8S3 — CID 59487946
disodium;2-chloro-5-(3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate (PubChem CID 59487946) has the molecular formula C12H7ClNa2O8S3 and a molecular weight of 456.81 g/mol. Its IUPAC name is disodium;2-chloro-5-(3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate.
| Compound Name | disodium;2-chloro-5-(3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 59487946 |
| Molecular Formula | C12H7ClNa2O8S3 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 455.88 |
| IUPAC Name | disodium;2-chloro-5-(3-oxidoperoxysulfanylphenyl)sulfonylbenzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)c2cccc(SOO[O-])c2)ccc1Cl.[Na+].[Na+] |
| InChI | InChI=1S/C12H9ClO8S3.2Na/c13-11-5-4-10(7-12(11)24(17,18)19)23(15,16)9-3-1-2-8(6-9)22-21-20-14;;/h1-7,14H,(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | FTEJZYGLVAZVOI-UHFFFAOYSA-L |
| XLogP | -4.68 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|