C21H18NO9S3-3 — CID 21023408
3-[[(3-oxidoperoxysulfanylphenyl)methyl-[(3-sulfonatophenyl)methyl]amino]methyl]benzenesulfonate (PubChem CID 21023408) has the molecular formula C21H18NO9S3-3 and a molecular weight of 524.57 g/mol. Its IUPAC name is 3-[[(3-oxidoperoxysulfanylphenyl)methyl-[(3-sulfonatophenyl)methyl]amino]methyl]benzenesulfonate.
| Compound Name | 3-[[(3-oxidoperoxysulfanylphenyl)methyl-[(3-sulfonatophenyl)methyl]amino]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 21023408 |
| Molecular Formula | C21H18NO9S3-3 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 3-[[(3-oxidoperoxysulfanylphenyl)methyl-[(3-sulfonatophenyl)methyl]amino]methyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(CN(Cc2cccc(SOO[O-])c2)Cc2cccc(S(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H21NO9S3/c23-30-31-32-19-7-1-4-16(10-19)13-22(14-17-5-2-8-20(11-17)33(24,25)26)15-18-6-3-9-21(12-18)34(27,28)29/h1-12,23H,13-15H2,(H,24,25,26)(H,27,28,29)/p-3 |
| InChIKey | VWJKTKZRNPGOTO-UHFFFAOYSA-K |
| XLogP | 1.93 |
| TPSA | 159.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|