C20H24N2 — CID 57276396
3-(3-amino-3-methylbut-1-enyl)-8-methyl-5-propan-2-ylazulene-1-carbonitrile (PubChem CID 57276396) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-(3-amino-3-methylbut-1-enyl)-8-methyl-5-propan-2-ylazulene-1-carbonitrile.
| Compound Name | 3-(3-amino-3-methylbut-1-enyl)-8-methyl-5-propan-2-ylazulene-1-carbonitrile |
|---|---|
| PubChem CID | 57276396 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-(3-amino-3-methylbut-1-enyl)-8-methyl-5-propan-2-ylazulene-1-carbonitrile |
| SMILES | Cc1ccc(C(C)C)cc2c(C=CC(C)(C)N)cc(C#N)c1-2 |
| InChI | InChI=1S/C20H24N2/c1-13(2)15-7-6-14(3)19-17(12-21)10-16(18(19)11-15)8-9-20(4,5)22/h6-11,13H,22H2,1-5H3 |
| InChIKey | FMOCMEFOTHCRRB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |