C21H24O — CID 23257836
(2E,4E)-5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal (PubChem CID 23257836) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (2E,4E)-5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal.
| Compound Name | (2E,4E)-5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 23257836 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2E,4E)-5-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methylpenta-2,4-dienal |
| SMILES | CC(/C=C/c1cc(C)c2cc(C(C)C)ccc(C)c1-2)=C\C=O |
| InChI | InChI=1S/C21H24O/c1-14(2)18-9-7-16(4)21-19(8-6-15(3)10-11-22)12-17(5)20(21)13-18/h6-14H,1-5H3/b8-6+,15-10+ |
| InChIKey | AETKBNBENHOMFZ-UYLQCNQNSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|