C16H21NaO4S — CID 173410204
sodium;3-ethyl-4-methoxy-7-propan-2-ylazulene-1-sulfonic acid;hydride (PubChem CID 173410204) has the molecular formula C16H21NaO4S and a molecular weight of 332.40 g/mol. Its IUPAC name is sodium;3-ethyl-4-methoxy-7-propan-2-ylazulene-1-sulfonic acid;hydride.
| Compound Name | sodium;3-ethyl-4-methoxy-7-propan-2-ylazulene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173410204 |
| Molecular Formula | C16H21NaO4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | sodium;3-ethyl-4-methoxy-7-propan-2-ylazulene-1-sulfonic acid;hydride |
| SMILES | CCc1cc(S(=O)(=O)O)c2cc(C(C)C)ccc(OC)c1-2.[H-].[Na+] |
| InChI | InChI=1S/C16H20O4S.Na.H/c1-5-11-9-15(21(17,18)19)13-8-12(10(2)3)6-7-14(20-4)16(11)13;;/h6-10H,5H2,1-4H3,(H,17,18,19);;/q;+1;-1 |
| InChIKey | VEILSOHIQRAJAQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|