C16H19NaO4S — CID 23713537
sodium 3-ethyl-4-methoxy-6-propan-2-ylazulene-1-sulfonate (PubChem CID 23713537) has the molecular formula C16H19NaO4S and a molecular weight of 330.38 g/mol. Its IUPAC name is sodium 3-ethyl-4-methoxy-6-propan-2-ylazulene-1-sulfonate.
| Compound Name | sodium 3-ethyl-4-methoxy-6-propan-2-ylazulene-1-sulfonate |
|---|---|
| PubChem CID | 23713537 |
| Molecular Formula | C16H19NaO4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | sodium 3-ethyl-4-methoxy-6-propan-2-ylazulene-1-sulfonate |
| SMILES | CCc1cc(S(=O)(=O)[O-])c2ccc(C(C)C)cc(OC)c1-2.[Na+] |
| InChI | InChI=1S/C16H20O4S.Na/c1-5-11-9-15(21(17,18)19)13-7-6-12(10(2)3)8-14(20-4)16(11)13;/h6-10H,5H2,1-4H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | WKWXBVCHVXAQMV-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|