C9H11NaO4S — CID 140661935
sodium 4-ethyl-2-methoxybenzenesulfonate (PubChem CID 140661935) has the molecular formula C9H11NaO4S and a molecular weight of 238.24 g/mol. Its IUPAC name is sodium 4-ethyl-2-methoxybenzenesulfonate.
| Compound Name | sodium 4-ethyl-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 140661935 |
| Molecular Formula | C9H11NaO4S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | sodium 4-ethyl-2-methoxybenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)[O-])c(OC)c1.[Na+] |
| InChI | InChI=1S/C9H12O4S.Na/c1-3-7-4-5-9(14(10,11)12)8(6-7)13-2;/h4-6H,3H2,1-2H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | VLGYXPOQMXAIPC-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|