C10H14NNaO4S — CID 170867429
sodium 5-(3-aminopropyl)-2-methoxybenzenesulfonate (PubChem CID 170867429) has the molecular formula C10H14NNaO4S and a molecular weight of 267.28 g/mol. Its IUPAC name is sodium 5-(3-aminopropyl)-2-methoxybenzenesulfonate.
| Compound Name | sodium 5-(3-aminopropyl)-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 170867429 |
| Molecular Formula | C10H14NNaO4S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | sodium 5-(3-aminopropyl)-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(CCCN)cc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H15NO4S.Na/c1-15-9-5-4-8(3-2-6-11)7-10(9)16(12,13)14;/h4-5,7H,2-3,6,11H2,1H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | QAMBHCSEKYHZRT-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|